About 3,3-dimethoxy-1-methyl-4a,8a-dihydro-4H-isoquinoline
3,3-dimethoxy-1-methyl-4a,8a-dihydro-4H-isoquinoline (PubChem CID 141069815) has the molecular formula C12H17NO2
and a molecular weight of 207.27 g/mol. Its IUPAC name is 3,3-dimethoxy-1-methyl-4a,8a-dihydro-4H-isoquinoline.
Molecular Properties
| Compound Name | 3,3-dimethoxy-1-methyl-4a,8a-dihydro-4H-isoquinoline |
| PubChem CID | 141069815 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | 3,3-dimethoxy-1-methyl-4a,8a-dihydro-4H-isoquinoline |
| SMILES | COC1(OC)CC2C=CC=CC2C(C)=N1 |
| InChI | InChI=1S/C12H17NO2/c1-9-11-7-5-4-6-10(11)8-12(13-9,14-2)15-3/h4-7,10-11H,8H2,1-3H3 |
| InChIKey | KXJKWHNSGPBSKJ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 3,3-dimethoxy-1-methyl-4a,8a-dihydro-4H-isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dimethoxy-1-methyl-4a,8a-dihydro-4H-isoquinoline?
The IUPAC name of 3,3-dimethoxy-1-methyl-4a,8a-dihydro-4H-isoquinoline (CID 141069815) is 3,3-dimethoxy-1-methyl-4a,8a-dihydro-4H-isoquinoline.
What is the SMILES notation for 3,3-dimethoxy-1-methyl-4a,8a-dihydro-4H-isoquinoline?
The canonical SMILES for 3,3-dimethoxy-1-methyl-4a,8a-dihydro-4H-isoquinoline is COC1(OC)CC2C=CC=CC2C(C)=N1.
What is the InChIKey of 3,3-dimethoxy-1-methyl-4a,8a-dihydro-4H-isoquinoline?
The InChIKey is KXJKWHNSGPBSKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO2/c1-9-11-7-5-4-6-10(11)8-12(13-9,14-2)15-3/h4-7,10-11H,8H2,1-3H3.
What are the key properties of 3,3-dimethoxy-1-methyl-4a,8a-dihydro-4H-isoquinoline?
3,3-dimethoxy-1-methyl-4a,8a-dihydro-4H-isoquinoline has a molecular weight of 207.27 g/mol, XLogP of 2.16, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dimethoxy-1-methyl-4a,8a-dihydro-4H-isoquinoline is sourced from PubChem (CID 141069815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).