About 5-methyl-1H-pyrimidine-2,4-dione;morpholine
5-methyl-1H-pyrimidine-2,4-dione;morpholine (PubChem CID 141070261) has the molecular formula C9H15N3O3
and a molecular weight of 213.24 g/mol. Its IUPAC name is 5-methyl-1H-pyrimidine-2,4-dione;morpholine.
Molecular Properties
| Compound Name | 5-methyl-1H-pyrimidine-2,4-dione;morpholine |
| PubChem CID | 141070261 |
| Molecular Formula | C9H15N3O3 |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.11 |
| IUPAC Name | 5-methyl-1H-pyrimidine-2,4-dione;morpholine |
| SMILES | C1COCCN1.Cc1c[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C5H6N2O2.C4H9NO/c1-3-2-6-5(9)7-4(3)8;1-3-6-4-2-5-1/h2H,1H3,(H2,6,7,8,9);5H,1-4H2 |
| InChIKey | XNAVJZIWHRFLMD-UHFFFAOYSA-N |
| XLogP | -1.02 |
| TPSA | 86.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-methyl-1H-pyrimidine-2,4-dione;morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-1H-pyrimidine-2,4-dione;morpholine?
The IUPAC name of 5-methyl-1H-pyrimidine-2,4-dione;morpholine (CID 141070261) is 5-methyl-1H-pyrimidine-2,4-dione;morpholine.
What is the SMILES notation for 5-methyl-1H-pyrimidine-2,4-dione;morpholine?
The canonical SMILES for 5-methyl-1H-pyrimidine-2,4-dione;morpholine is C1COCCN1.Cc1c[nH]c(=O)[nH]c1=O.
What is the InChIKey of 5-methyl-1H-pyrimidine-2,4-dione;morpholine?
The InChIKey is XNAVJZIWHRFLMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N2O2.C4H9NO/c1-3-2-6-5(9)7-4(3)8;1-3-6-4-2-5-1/h2H,1H3,(H2,6,7,8,9);5H,1-4H2.
What are the key properties of 5-methyl-1H-pyrimidine-2,4-dione;morpholine?
5-methyl-1H-pyrimidine-2,4-dione;morpholine has a molecular weight of 213.24 g/mol, XLogP of -1.02, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-1H-pyrimidine-2,4-dione;morpholine is sourced from PubChem (CID 141070261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).