C18H22N2O2S2 — CID 14107029
N-[(2R,11bS)-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl]-N-methylthiophene-3-sulfonamide (PubChem CID 14107029) has the molecular formula C18H22N2O2S2 and a molecular weight of 362.52 g/mol. Its IUPAC name is N-[(2R,11bS)-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl]-N-methylthiophene-3-sulfonamide.
| Compound Name | N-[(2R,11bS)-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl]-N-methylthiophene-3-sulfonamide |
|---|---|
| PubChem CID | 14107029 |
| Molecular Formula | C18H22N2O2S2 |
| Molecular Weight | 362.52 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | N-[(2R,11bS)-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl]-N-methylthiophene-3-sulfonamide |
| SMILES | CN([C@@H]1CCN2CCc3ccccc3[C@@H]2C1)S(=O)(=O)c1ccsc1 |
| InChI | InChI=1S/C18H22N2O2S2/c1-19(24(21,22)16-8-11-23-13-16)15-7-10-20-9-6-14-4-2-3-5-17(14)18(20)12-15/h2-5,8,11,13,15,18H,6-7,9-10,12H2,1H3/t15-,18+/m1/s1 |
| InChIKey | BTSCXZZTZWNWEK-QAPCUYQASA-N |
| XLogP | 3.13 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.52 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |