C16H25N2O3P — CID 14107050
(2R,11bS)-N-dimethoxyphosphoryl-N-methyl-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-amine (PubChem CID 14107050) has the molecular formula C16H25N2O3P and a molecular weight of 324.36 g/mol. Its IUPAC name is (2R,11bS)-N-dimethoxyphosphoryl-N-methyl-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-amine.
| Compound Name | (2R,11bS)-N-dimethoxyphosphoryl-N-methyl-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-amine |
|---|---|
| PubChem CID | 14107050 |
| Molecular Formula | C16H25N2O3P |
| Molecular Weight | 324.36 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | (2R,11bS)-N-dimethoxyphosphoryl-N-methyl-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-amine |
| SMILES | COP(=O)(OC)N(C)[C@@H]1CCN2CCc3ccccc3[C@@H]2C1 |
| InChI | InChI=1S/C16H25N2O3P/c1-17(22(19,20-2)21-3)14-9-11-18-10-8-13-6-4-5-7-15(13)16(18)12-14/h4-7,14,16H,8-12H2,1-3H3/t14-,16+/m1/s1 |
| InChIKey | XVJPSTKVBVXNBN-ZBFHGGJFSA-N |
| XLogP | 3.08 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.36 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|