About 2,4,4-trimethylpentan-2-yl 2-methoxyacetate
2,4,4-trimethylpentan-2-yl 2-methoxyacetate (PubChem CID 141070664) has the molecular formula C11H22O3
and a molecular weight of 202.29 g/mol. Its IUPAC name is 2,4,4-trimethylpentan-2-yl 2-methoxyacetate.
Molecular Properties
| Compound Name | 2,4,4-trimethylpentan-2-yl 2-methoxyacetate |
| PubChem CID | 141070664 |
| Molecular Formula | C11H22O3 |
| Molecular Weight | 202.29 g/mol |
| Exact Mass | 202.16 |
| IUPAC Name | 2,4,4-trimethylpentan-2-yl 2-methoxyacetate |
| SMILES | COCC(=O)OC(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C11H22O3/c1-10(2,3)8-11(4,5)14-9(12)7-13-6/h7-8H2,1-6H3 |
| InChIKey | UJOBUJNJAXOAHT-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.29 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,4,4-trimethylpentan-2-yl 2-methoxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4,4-trimethylpentan-2-yl 2-methoxyacetate?
The IUPAC name of 2,4,4-trimethylpentan-2-yl 2-methoxyacetate (CID 141070664) is 2,4,4-trimethylpentan-2-yl 2-methoxyacetate.
What is the SMILES notation for 2,4,4-trimethylpentan-2-yl 2-methoxyacetate?
The canonical SMILES for 2,4,4-trimethylpentan-2-yl 2-methoxyacetate is COCC(=O)OC(C)(C)CC(C)(C)C.
What is the InChIKey of 2,4,4-trimethylpentan-2-yl 2-methoxyacetate?
The InChIKey is UJOBUJNJAXOAHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22O3/c1-10(2,3)8-11(4,5)14-9(12)7-13-6/h7-8H2,1-6H3.
What are the key properties of 2,4,4-trimethylpentan-2-yl 2-methoxyacetate?
2,4,4-trimethylpentan-2-yl 2-methoxyacetate has a molecular weight of 202.29 g/mol, XLogP of 2.39, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4,4-trimethylpentan-2-yl 2-methoxyacetate is sourced from PubChem (CID 141070664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).