About 1,1-diphenyl-2,3-dihydropyrrol-1-ium perchlorate
1,1-diphenyl-2,3-dihydropyrrol-1-ium perchlorate (PubChem CID 141071377) has the molecular formula C16H16ClNO4
and a molecular weight of 321.76 g/mol. Its IUPAC name is 1,1-diphenyl-2,3-dihydropyrrol-1-ium perchlorate.
Molecular Properties
| Compound Name | 1,1-diphenyl-2,3-dihydropyrrol-1-ium perchlorate |
| PubChem CID | 141071377 |
| Molecular Formula | C16H16ClNO4 |
| Molecular Weight | 321.76 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | 1,1-diphenyl-2,3-dihydropyrrol-1-ium perchlorate |
| SMILES | C1=C[N+](c2ccccc2)(c2ccccc2)CC1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C16H16N.ClHO4/c1-3-9-15(10-4-1)17(13-7-8-14-17)16-11-5-2-6-12-16;2-1(3,4)5/h1-7,9-13H,8,14H2;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | HIWNBYYMPQNXOA-UHFFFAOYSA-M |
| XLogP | -0.51 |
| TPSA | 92.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.76 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 1,1-diphenyl-2,3-dihydropyrrol-1-ium perchlorate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-diphenyl-2,3-dihydropyrrol-1-ium perchlorate?
The IUPAC name of 1,1-diphenyl-2,3-dihydropyrrol-1-ium perchlorate (CID 141071377) is 1,1-diphenyl-2,3-dihydropyrrol-1-ium perchlorate.
What is the SMILES notation for 1,1-diphenyl-2,3-dihydropyrrol-1-ium perchlorate?
The canonical SMILES for 1,1-diphenyl-2,3-dihydropyrrol-1-ium perchlorate is C1=C[N+](c2ccccc2)(c2ccccc2)CC1.[O-][Cl+3]([O-])([O-])[O-].
What is the InChIKey of 1,1-diphenyl-2,3-dihydropyrrol-1-ium perchlorate?
The InChIKey is HIWNBYYMPQNXOA-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H16N.ClHO4/c1-3-9-15(10-4-1)17(13-7-8-14-17)16-11-5-2-6-12-16;2-1(3,4)5/h1-7,9-13H,8,14H2;(H,2,3,4,5)/q+1;/p-1.
What are the key properties of 1,1-diphenyl-2,3-dihydropyrrol-1-ium perchlorate?
1,1-diphenyl-2,3-dihydropyrrol-1-ium perchlorate has a molecular weight of 321.76 g/mol, XLogP of -0.51, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-diphenyl-2,3-dihydropyrrol-1-ium perchlorate is sourced from PubChem (CID 141071377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).