About 2-methyl-6-[5-methyl-2,4-di(propan-2-yl)phenyl]-3,5-di(propan-2-yl)phenol
2-methyl-6-[5-methyl-2,4-di(propan-2-yl)phenyl]-3,5-di(propan-2-yl)phenol (PubChem CID 141071762) has the molecular formula C26H38O
and a molecular weight of 366.59 g/mol. Its IUPAC name is 2-methyl-6-[5-methyl-2,4-di(propan-2-yl)phenyl]-3,5-di(propan-2-yl)phenol.
Molecular Properties
| Compound Name | 2-methyl-6-[5-methyl-2,4-di(propan-2-yl)phenyl]-3,5-di(propan-2-yl)phenol |
| PubChem CID | 141071762 |
| Molecular Formula | C26H38O |
| Molecular Weight | 366.59 g/mol |
| Exact Mass | 366.29 |
| IUPAC Name | 2-methyl-6-[5-methyl-2,4-di(propan-2-yl)phenyl]-3,5-di(propan-2-yl)phenol |
| SMILES | Cc1cc(-c2c(C(C)C)cc(C(C)C)c(C)c2O)c(C(C)C)cc1C(C)C |
| InChI | InChI=1S/C26H38O/c1-14(2)20-12-22(16(5)6)24(11-18(20)9)25-23(17(7)8)13-21(15(3)4)19(10)26(25)27/h11-17,27H,1-10H3 |
| InChIKey | OJTWSHFWCKRKAE-UHFFFAOYSA-N |
| XLogP | 8.17 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 366.59 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-methyl-6-[5-methyl-2,4-di(propan-2-yl)phenyl]-3,5-di(propan-2-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-6-[5-methyl-2,4-di(propan-2-yl)phenyl]-3,5-di(propan-2-yl)phenol?
The IUPAC name of 2-methyl-6-[5-methyl-2,4-di(propan-2-yl)phenyl]-3,5-di(propan-2-yl)phenol (CID 141071762) is 2-methyl-6-[5-methyl-2,4-di(propan-2-yl)phenyl]-3,5-di(propan-2-yl)phenol.
What is the SMILES notation for 2-methyl-6-[5-methyl-2,4-di(propan-2-yl)phenyl]-3,5-di(propan-2-yl)phenol?
The canonical SMILES for 2-methyl-6-[5-methyl-2,4-di(propan-2-yl)phenyl]-3,5-di(propan-2-yl)phenol is Cc1cc(-c2c(C(C)C)cc(C(C)C)c(C)c2O)c(C(C)C)cc1C(C)C.
What is the InChIKey of 2-methyl-6-[5-methyl-2,4-di(propan-2-yl)phenyl]-3,5-di(propan-2-yl)phenol?
The InChIKey is OJTWSHFWCKRKAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H38O/c1-14(2)20-12-22(16(5)6)24(11-18(20)9)25-23(17(7)8)13-21(15(3)4)19(10)26(25)27/h11-17,27H,1-10H3.
What are the key properties of 2-methyl-6-[5-methyl-2,4-di(propan-2-yl)phenyl]-3,5-di(propan-2-yl)phenol?
2-methyl-6-[5-methyl-2,4-di(propan-2-yl)phenyl]-3,5-di(propan-2-yl)phenol has a molecular weight of 366.59 g/mol, XLogP of 8.17, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-6-[5-methyl-2,4-di(propan-2-yl)phenyl]-3,5-di(propan-2-yl)phenol is sourced from PubChem (CID 141071762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).