About 2,6-bis(2-hydroxyethylamino)-6-methylcyclohexa-1,3-dien-1-ol
2,6-bis(2-hydroxyethylamino)-6-methylcyclohexa-1,3-dien-1-ol (PubChem CID 141071835) has the molecular formula C11H20N2O3
and a molecular weight of 228.29 g/mol. Its IUPAC name is 2,6-bis(2-hydroxyethylamino)-6-methylcyclohexa-1,3-dien-1-ol.
Molecular Properties
| Compound Name | 2,6-bis(2-hydroxyethylamino)-6-methylcyclohexa-1,3-dien-1-ol |
| PubChem CID | 141071835 |
| Molecular Formula | C11H20N2O3 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | 2,6-bis(2-hydroxyethylamino)-6-methylcyclohexa-1,3-dien-1-ol |
| SMILES | CC1(NCCO)CC=CC(NCCO)=C1O |
| InChI | InChI=1S/C11H20N2O3/c1-11(13-6-8-15)4-2-3-9(10(11)16)12-5-7-14/h2-3,12-16H,4-8H2,1H3 |
| InChIKey | WKTJFHGVPXWMQF-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 84.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2,6-bis(2-hydroxyethylamino)-6-methylcyclohexa-1,3-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-bis(2-hydroxyethylamino)-6-methylcyclohexa-1,3-dien-1-ol?
The IUPAC name of 2,6-bis(2-hydroxyethylamino)-6-methylcyclohexa-1,3-dien-1-ol (CID 141071835) is 2,6-bis(2-hydroxyethylamino)-6-methylcyclohexa-1,3-dien-1-ol.
What is the SMILES notation for 2,6-bis(2-hydroxyethylamino)-6-methylcyclohexa-1,3-dien-1-ol?
The canonical SMILES for 2,6-bis(2-hydroxyethylamino)-6-methylcyclohexa-1,3-dien-1-ol is CC1(NCCO)CC=CC(NCCO)=C1O.
What is the InChIKey of 2,6-bis(2-hydroxyethylamino)-6-methylcyclohexa-1,3-dien-1-ol?
The InChIKey is WKTJFHGVPXWMQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2O3/c1-11(13-6-8-15)4-2-3-9(10(11)16)12-5-7-14/h2-3,12-16H,4-8H2,1H3.
What are the key properties of 2,6-bis(2-hydroxyethylamino)-6-methylcyclohexa-1,3-dien-1-ol?
2,6-bis(2-hydroxyethylamino)-6-methylcyclohexa-1,3-dien-1-ol has a molecular weight of 228.29 g/mol, XLogP of -0.36, 6 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-bis(2-hydroxyethylamino)-6-methylcyclohexa-1,3-dien-1-ol is sourced from PubChem (CID 141071835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).