C12H19NO5S — CID 141072320
(2R,4S)-4-acetylsulfanyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid (PubChem CID 141072320) has the molecular formula C12H19NO5S and a molecular weight of 289.35 g/mol. Its IUPAC name is (2R,4S)-4-acetylsulfanyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2R,4S)-4-acetylsulfanyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 141072320 |
| Molecular Formula | C12H19NO5S |
| Molecular Weight | 289.35 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | (2R,4S)-4-acetylsulfanyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid |
| SMILES | CC(=O)S[C@H]1C[C@H](C(=O)O)N(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C12H19NO5S/c1-7(14)19-8-5-9(10(15)16)13(6-8)11(17)18-12(2,3)4/h8-9H,5-6H2,1-4H3,(H,15,16)/t8-,9+/m0/s1 |
| InChIKey | CFSDUXLGTSSQCH-DTWKUNHWSA-N |
| XLogP | 1.73 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.35 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|