About 3,4-diphenyl-2H-oxazine
3,4-diphenyl-2H-oxazine (PubChem CID 141073202) has the molecular formula C16H13NO
and a molecular weight of 235.29 g/mol. Its IUPAC name is 3,4-diphenyl-2H-oxazine.
Molecular Properties
| Compound Name | 3,4-diphenyl-2H-oxazine |
| PubChem CID | 141073202 |
| Molecular Formula | C16H13NO |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 3,4-diphenyl-2H-oxazine |
| SMILES | C1=CC(c2ccccc2)=C(c2ccccc2)NO1 |
| InChI | InChI=1S/C16H13NO/c1-3-7-13(8-4-1)15-11-12-18-17-16(15)14-9-5-2-6-10-14/h1-12,17H |
| InChIKey | HWTZPJQQVBYBGP-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 3,4-diphenyl-2H-oxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-diphenyl-2H-oxazine?
The IUPAC name of 3,4-diphenyl-2H-oxazine (CID 141073202) is 3,4-diphenyl-2H-oxazine.
What is the SMILES notation for 3,4-diphenyl-2H-oxazine?
The canonical SMILES for 3,4-diphenyl-2H-oxazine is C1=CC(c2ccccc2)=C(c2ccccc2)NO1.
What is the InChIKey of 3,4-diphenyl-2H-oxazine?
The InChIKey is HWTZPJQQVBYBGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13NO/c1-3-7-13(8-4-1)15-11-12-18-17-16(15)14-9-5-2-6-10-14/h1-12,17H.
What are the key properties of 3,4-diphenyl-2H-oxazine?
3,4-diphenyl-2H-oxazine has a molecular weight of 235.29 g/mol, XLogP of 3.60, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-diphenyl-2H-oxazine is sourced from PubChem (CID 141073202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).