C30H36FN3O2 — CID 141074176
3-[3-butyl-2-[4-(3-fluorophenoxy)phenyl]benzimidazol-5-yl]oxy-N,N-diethylpropan-1-amine (PubChem CID 141074176) has the molecular formula C30H36FN3O2 and a molecular weight of 489.64 g/mol. Its IUPAC name is 3-[3-butyl-2-[4-(3-fluorophenoxy)phenyl]benzimidazol-5-yl]oxy-N,N-diethylpropan-1-amine.
| Compound Name | 3-[3-butyl-2-[4-(3-fluorophenoxy)phenyl]benzimidazol-5-yl]oxy-N,N-diethylpropan-1-amine |
|---|---|
| PubChem CID | 141074176 |
| Molecular Formula | C30H36FN3O2 |
| Molecular Weight | 489.64 g/mol |
| Exact Mass | 489.28 |
| IUPAC Name | 3-[3-butyl-2-[4-(3-fluorophenoxy)phenyl]benzimidazol-5-yl]oxy-N,N-diethylpropan-1-amine |
| SMILES | CCCCn1c(-c2ccc(Oc3cccc(F)c3)cc2)nc2ccc(OCCCN(CC)CC)cc21 |
| InChI | InChI=1S/C30H36FN3O2/c1-4-7-19-34-29-22-26(35-20-9-18-33(5-2)6-3)16-17-28(29)32-30(34)23-12-14-25(15-13-23)36-27-11-8-10-24(31)21-27/h8,10-17,21-22H,4-7,9,18-20H2,1-3H3 |
| InChIKey | DUJDKRLULIJERH-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 39.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.64 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|