About 1'-(cyclopropylmethyl)spiro[1,3-dihydroindene-2,4'-piperidine]-1-ol
1'-(cyclopropylmethyl)spiro[1,3-dihydroindene-2,4'-piperidine]-1-ol (PubChem CID 141074704) has the molecular formula C17H23NO
and a molecular weight of 257.38 g/mol. Its IUPAC name is 1'-(cyclopropylmethyl)spiro[1,3-dihydroindene-2,4'-piperidine]-1-ol.
Molecular Properties
| Compound Name | 1'-(cyclopropylmethyl)spiro[1,3-dihydroindene-2,4'-piperidine]-1-ol |
| PubChem CID | 141074704 |
| Molecular Formula | C17H23NO |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.18 |
| IUPAC Name | 1'-(cyclopropylmethyl)spiro[1,3-dihydroindene-2,4'-piperidine]-1-ol |
| SMILES | OC1c2ccccc2CC12CCN(CC1CC1)CC2 |
| InChI | InChI=1S/C17H23NO/c19-16-15-4-2-1-3-14(15)11-17(16)7-9-18(10-8-17)12-13-5-6-13/h1-4,13,16,19H,5-12H2 |
| InChIKey | JRENROPSDZUULW-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1'-(cyclopropylmethyl)spiro[1,3-dihydroindene-2,4'-piperidine]-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1'-(cyclopropylmethyl)spiro[1,3-dihydroindene-2,4'-piperidine]-1-ol?
The IUPAC name of 1'-(cyclopropylmethyl)spiro[1,3-dihydroindene-2,4'-piperidine]-1-ol (CID 141074704) is 1'-(cyclopropylmethyl)spiro[1,3-dihydroindene-2,4'-piperidine]-1-ol.
What is the SMILES notation for 1'-(cyclopropylmethyl)spiro[1,3-dihydroindene-2,4'-piperidine]-1-ol?
The canonical SMILES for 1'-(cyclopropylmethyl)spiro[1,3-dihydroindene-2,4'-piperidine]-1-ol is OC1c2ccccc2CC12CCN(CC1CC1)CC2.
What is the InChIKey of 1'-(cyclopropylmethyl)spiro[1,3-dihydroindene-2,4'-piperidine]-1-ol?
The InChIKey is JRENROPSDZUULW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23NO/c19-16-15-4-2-1-3-14(15)11-17(16)7-9-18(10-8-17)12-13-5-6-13/h1-4,13,16,19H,5-12H2.
What are the key properties of 1'-(cyclopropylmethyl)spiro[1,3-dihydroindene-2,4'-piperidine]-1-ol?
1'-(cyclopropylmethyl)spiro[1,3-dihydroindene-2,4'-piperidine]-1-ol has a molecular weight of 257.38 g/mol, XLogP of 2.77, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1'-(cyclopropylmethyl)spiro[1,3-dihydroindene-2,4'-piperidine]-1-ol is sourced from PubChem (CID 141074704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).