About 1-[(4-fluorophenyl)methyl]-1,2-dimethoxy-3,4-dihydroisoquinoline;hydrochloride
1-[(4-fluorophenyl)methyl]-1,2-dimethoxy-3,4-dihydroisoquinoline;hydrochloride (PubChem CID 141074894) has the molecular formula C18H21ClFNO2
and a molecular weight of 337.82 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-1,2-dimethoxy-3,4-dihydroisoquinoline;hydrochloride.
Molecular Properties
| Compound Name | 1-[(4-fluorophenyl)methyl]-1,2-dimethoxy-3,4-dihydroisoquinoline;hydrochloride |
| PubChem CID | 141074894 |
| Molecular Formula | C18H21ClFNO2 |
| Molecular Weight | 337.82 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-1,2-dimethoxy-3,4-dihydroisoquinoline;hydrochloride |
| SMILES | CON1CCc2ccccc2C1(Cc1ccc(F)cc1)OC.Cl |
| InChI | InChI=1S/C18H20FNO2.ClH/c1-21-18(13-14-7-9-16(19)10-8-14)17-6-4-3-5-15(17)11-12-20(18)22-2;/h3-10H,11-13H2,1-2H3;1H |
| InChIKey | FTFWMXZIFAXETC-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.82 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(4-fluorophenyl)methyl]-1,2-dimethoxy-3,4-dihydroisoquinoline;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4-fluorophenyl)methyl]-1,2-dimethoxy-3,4-dihydroisoquinoline;hydrochloride?
The IUPAC name of 1-[(4-fluorophenyl)methyl]-1,2-dimethoxy-3,4-dihydroisoquinoline;hydrochloride (CID 141074894) is 1-[(4-fluorophenyl)methyl]-1,2-dimethoxy-3,4-dihydroisoquinoline;hydrochloride.
What is the SMILES notation for 1-[(4-fluorophenyl)methyl]-1,2-dimethoxy-3,4-dihydroisoquinoline;hydrochloride?
The canonical SMILES for 1-[(4-fluorophenyl)methyl]-1,2-dimethoxy-3,4-dihydroisoquinoline;hydrochloride is CON1CCc2ccccc2C1(Cc1ccc(F)cc1)OC.Cl.
What is the InChIKey of 1-[(4-fluorophenyl)methyl]-1,2-dimethoxy-3,4-dihydroisoquinoline;hydrochloride?
The InChIKey is FTFWMXZIFAXETC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20FNO2.ClH/c1-21-18(13-14-7-9-16(19)10-8-14)17-6-4-3-5-15(17)11-12-20(18)22-2;/h3-10H,11-13H2,1-2H3;1H.
What are the key properties of 1-[(4-fluorophenyl)methyl]-1,2-dimethoxy-3,4-dihydroisoquinoline;hydrochloride?
1-[(4-fluorophenyl)methyl]-1,2-dimethoxy-3,4-dihydroisoquinoline;hydrochloride has a molecular weight of 337.82 g/mol, XLogP of 3.71, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4-fluorophenyl)methyl]-1,2-dimethoxy-3,4-dihydroisoquinoline;hydrochloride is sourced from PubChem (CID 141074894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).