About 1-[(4-fluorophenyl)methyl]-1,2-dimethoxy-3,4-dihydroisoquinoline
1-[(4-fluorophenyl)methyl]-1,2-dimethoxy-3,4-dihydroisoquinoline (PubChem CID 141074895) has the molecular formula C18H20FNO2
and a molecular weight of 301.36 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-1,2-dimethoxy-3,4-dihydroisoquinoline.
Molecular Properties
| Compound Name | 1-[(4-fluorophenyl)methyl]-1,2-dimethoxy-3,4-dihydroisoquinoline |
| PubChem CID | 141074895 |
| Molecular Formula | C18H20FNO2 |
| Molecular Weight | 301.36 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-1,2-dimethoxy-3,4-dihydroisoquinoline |
| SMILES | CON1CCc2ccccc2C1(Cc1ccc(F)cc1)OC |
| InChI | InChI=1S/C18H20FNO2/c1-21-18(13-14-7-9-16(19)10-8-14)17-6-4-3-5-15(17)11-12-20(18)22-2/h3-10H,11-13H2,1-2H3 |
| InChIKey | DYVDXTVBLOKACG-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.36 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(4-fluorophenyl)methyl]-1,2-dimethoxy-3,4-dihydroisoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4-fluorophenyl)methyl]-1,2-dimethoxy-3,4-dihydroisoquinoline?
The IUPAC name of 1-[(4-fluorophenyl)methyl]-1,2-dimethoxy-3,4-dihydroisoquinoline (CID 141074895) is 1-[(4-fluorophenyl)methyl]-1,2-dimethoxy-3,4-dihydroisoquinoline.
What is the SMILES notation for 1-[(4-fluorophenyl)methyl]-1,2-dimethoxy-3,4-dihydroisoquinoline?
The canonical SMILES for 1-[(4-fluorophenyl)methyl]-1,2-dimethoxy-3,4-dihydroisoquinoline is CON1CCc2ccccc2C1(Cc1ccc(F)cc1)OC.
What is the InChIKey of 1-[(4-fluorophenyl)methyl]-1,2-dimethoxy-3,4-dihydroisoquinoline?
The InChIKey is DYVDXTVBLOKACG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20FNO2/c1-21-18(13-14-7-9-16(19)10-8-14)17-6-4-3-5-15(17)11-12-20(18)22-2/h3-10H,11-13H2,1-2H3.
What are the key properties of 1-[(4-fluorophenyl)methyl]-1,2-dimethoxy-3,4-dihydroisoquinoline?
1-[(4-fluorophenyl)methyl]-1,2-dimethoxy-3,4-dihydroisoquinoline has a molecular weight of 301.36 g/mol, XLogP of 3.29, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4-fluorophenyl)methyl]-1,2-dimethoxy-3,4-dihydroisoquinoline is sourced from PubChem (CID 141074895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).