C14H14O6 — CID 141076006
[2-[4-methoxy-6-(oxomethylidene)cyclohexa-2,4-dien-1-yl]oxy-2-oxoethyl] 2-methylprop-2-enoate (PubChem CID 141076006) has the molecular formula C14H14O6 and a molecular weight of 278.26 g/mol. Its IUPAC name is [2-[4-methoxy-6-(oxomethylidene)cyclohexa-2,4-dien-1-yl]oxy-2-oxoethyl] 2-methylprop-2-enoate.
| Compound Name | [2-[4-methoxy-6-(oxomethylidene)cyclohexa-2,4-dien-1-yl]oxy-2-oxoethyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 141076006 |
| Molecular Formula | C14H14O6 |
| Molecular Weight | 278.26 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | [2-[4-methoxy-6-(oxomethylidene)cyclohexa-2,4-dien-1-yl]oxy-2-oxoethyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(=O)OC1C=CC(OC)=CC1=C=O |
| InChI | InChI=1S/C14H14O6/c1-9(2)14(17)19-8-13(16)20-12-5-4-11(18-3)6-10(12)7-15/h4-6,12H,1,8H2,2-3H3 |
| InChIKey | SHVWZAOLNZQOCU-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.26 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|