C8H9N3O3 — CID 141076496
methyl 3-(6-amino-2-oxo-1H-pyrimidin-5-yl)prop-2-enoate (PubChem CID 141076496) has the molecular formula C8H9N3O3 and a molecular weight of 195.18 g/mol. Its IUPAC name is methyl 3-(6-amino-2-oxo-1H-pyrimidin-5-yl)prop-2-enoate.
| Compound Name | methyl 3-(6-amino-2-oxo-1H-pyrimidin-5-yl)prop-2-enoate |
|---|---|
| PubChem CID | 141076496 |
| Molecular Formula | C8H9N3O3 |
| Molecular Weight | 195.18 g/mol |
| Exact Mass | 195.06 |
| IUPAC Name | methyl 3-(6-amino-2-oxo-1H-pyrimidin-5-yl)prop-2-enoate |
| SMILES | COC(=O)C=Cc1cnc(=O)[nH]c1N |
| InChI | InChI=1S/C8H9N3O3/c1-14-6(12)3-2-5-4-10-8(13)11-7(5)9/h2-4H,1H3,(H3,9,10,11,13) |
| InChIKey | OUIUYTFDTWWKSK-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.18 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|