About (2-methyl-1,3-dihydrotetrazol-5-yl)methanamine
(2-methyl-1,3-dihydrotetrazol-5-yl)methanamine (PubChem CID 141076668) has the molecular formula C3H9N5
and a molecular weight of 115.14 g/mol. Its IUPAC name is (2-methyl-1,3-dihydrotetrazol-5-yl)methanamine.
Molecular Properties
| Compound Name | (2-methyl-1,3-dihydrotetrazol-5-yl)methanamine |
| PubChem CID | 141076668 |
| Molecular Formula | C3H9N5 |
| Molecular Weight | 115.14 g/mol |
| Exact Mass | 115.09 |
| IUPAC Name | (2-methyl-1,3-dihydrotetrazol-5-yl)methanamine |
| SMILES | CN1NN=C(CN)N1 |
| InChI | InChI=1S/C3H9N5/c1-8-6-3(2-4)5-7-8/h7H,2,4H2,1H3,(H,5,6) |
| InChIKey | HHLNJFLCVPOXSE-UHFFFAOYSA-N |
| XLogP | -1.79 |
| TPSA | 65.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 115.14 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2-methyl-1,3-dihydrotetrazol-5-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methyl-1,3-dihydrotetrazol-5-yl)methanamine?
The IUPAC name of (2-methyl-1,3-dihydrotetrazol-5-yl)methanamine (CID 141076668) is (2-methyl-1,3-dihydrotetrazol-5-yl)methanamine.
What is the SMILES notation for (2-methyl-1,3-dihydrotetrazol-5-yl)methanamine?
The canonical SMILES for (2-methyl-1,3-dihydrotetrazol-5-yl)methanamine is CN1NN=C(CN)N1.
What is the InChIKey of (2-methyl-1,3-dihydrotetrazol-5-yl)methanamine?
The InChIKey is HHLNJFLCVPOXSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9N5/c1-8-6-3(2-4)5-7-8/h7H,2,4H2,1H3,(H,5,6).
What are the key properties of (2-methyl-1,3-dihydrotetrazol-5-yl)methanamine?
(2-methyl-1,3-dihydrotetrazol-5-yl)methanamine has a molecular weight of 115.14 g/mol, XLogP of -1.79, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methyl-1,3-dihydrotetrazol-5-yl)methanamine is sourced from PubChem (CID 141076668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).