C6H13NO9S — CID 141076916
[(2R,3S,4R,5R,6R)-5-amino-3,4,6-trihydroxy-2-(hydroxymethyl)oxan-2-yl] hydrogen sulfate (PubChem CID 141076916) has the molecular formula C6H13NO9S and a molecular weight of 275.24 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6R)-5-amino-3,4,6-trihydroxy-2-(hydroxymethyl)oxan-2-yl] hydrogen sulfate.
| Compound Name | [(2R,3S,4R,5R,6R)-5-amino-3,4,6-trihydroxy-2-(hydroxymethyl)oxan-2-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 141076916 |
| Molecular Formula | C6H13NO9S |
| Molecular Weight | 275.24 g/mol |
| Exact Mass | 275.03 |
| IUPAC Name | [(2R,3S,4R,5R,6R)-5-amino-3,4,6-trihydroxy-2-(hydroxymethyl)oxan-2-yl] hydrogen sulfate |
| SMILES | N[C@@H]1[C@@H](O)[C@H](O)[C@@](CO)(OS(=O)(=O)O)O[C@H]1O |
| InChI | InChI=1S/C6H13NO9S/c7-2-3(9)4(10)6(1-8,15-5(2)11)16-17(12,13)14/h2-5,8-11H,1,7H2,(H,12,13,14)/t2-,3-,4+,5-,6-/m1/s1 |
| InChIKey | QTUPVCIMGRGCAU-VFUOTHLCSA-N |
| XLogP | -4.11 |
| TPSA | 179.77 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.24 |
| LogP ≤ 5 | -4.11 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|