C20H13F4N3O2S — CID 141076952
4,8-bis(2,4-difluorophenyl)-2-methylsulfonyl-7H-pyrido[2,3-d]pyrimidine (PubChem CID 141076952) has the molecular formula C20H13F4N3O2S and a molecular weight of 435.40 g/mol. Its IUPAC name is 4,8-bis(2,4-difluorophenyl)-2-methylsulfonyl-7H-pyrido[2,3-d]pyrimidine.
| Compound Name | 4,8-bis(2,4-difluorophenyl)-2-methylsulfonyl-7H-pyrido[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 141076952 |
| Molecular Formula | C20H13F4N3O2S |
| Molecular Weight | 435.40 g/mol |
| Exact Mass | 435.07 |
| IUPAC Name | 4,8-bis(2,4-difluorophenyl)-2-methylsulfonyl-7H-pyrido[2,3-d]pyrimidine |
| SMILES | CS(=O)(=O)c1nc(-c2ccc(F)cc2F)c2c(n1)N(c1ccc(F)cc1F)CC=C2 |
| InChI | InChI=1S/C20H13F4N3O2S/c1-30(28,29)20-25-18(13-6-4-11(21)9-15(13)23)14-3-2-8-27(19(14)26-20)17-7-5-12(22)10-16(17)24/h2-7,9-10H,8H2,1H3 |
| InChIKey | QMECMGDDKJWNMA-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.40 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |