About potassium 1H-indole-5-sulfonate
potassium 1H-indole-5-sulfonate (PubChem CID 141077101) has the molecular formula C8H6KNO3S
and a molecular weight of 235.31 g/mol. Its IUPAC name is potassium 1H-indole-5-sulfonate.
Molecular Properties
| Compound Name | potassium 1H-indole-5-sulfonate |
| PubChem CID | 141077101 |
| Molecular Formula | C8H6KNO3S |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 234.97 |
| IUPAC Name | potassium 1H-indole-5-sulfonate |
| SMILES | O=S(=O)([O-])c1ccc2[nH]ccc2c1.[K+] |
| InChI | InChI=1S/C8H7NO3S.K/c10-13(11,12)7-1-2-8-6(5-7)3-4-9-8;/h1-5,9H,(H,10,11,12);/q;+1/p-1 |
| InChIKey | JGGUTDRVQWFERH-UHFFFAOYSA-M |
| XLogP | -1.92 |
| TPSA | 72.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | -1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze potassium 1H-indole-5-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium 1H-indole-5-sulfonate?
The IUPAC name of potassium 1H-indole-5-sulfonate (CID 141077101) is potassium 1H-indole-5-sulfonate.
What is the SMILES notation for potassium 1H-indole-5-sulfonate?
The canonical SMILES for potassium 1H-indole-5-sulfonate is O=S(=O)([O-])c1ccc2[nH]ccc2c1.[K+].
What is the InChIKey of potassium 1H-indole-5-sulfonate?
The InChIKey is JGGUTDRVQWFERH-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H7NO3S.K/c10-13(11,12)7-1-2-8-6(5-7)3-4-9-8;/h1-5,9H,(H,10,11,12);/q;+1/p-1.
What are the key properties of potassium 1H-indole-5-sulfonate?
potassium 1H-indole-5-sulfonate has a molecular weight of 235.31 g/mol, XLogP of -1.92, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 1H-indole-5-sulfonate is sourced from PubChem (CID 141077101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).