About 6-cyclopentyl-1,2-dihydropyrazine
6-cyclopentyl-1,2-dihydropyrazine (PubChem CID 141077395) has the molecular formula C9H14N2
and a molecular weight of 150.22 g/mol. Its IUPAC name is 6-cyclopentyl-1,2-dihydropyrazine.
Molecular Properties
| Compound Name | 6-cyclopentyl-1,2-dihydropyrazine |
| PubChem CID | 141077395 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | 6-cyclopentyl-1,2-dihydropyrazine |
| SMILES | C1=NC=C(C2CCCC2)NC1 |
| InChI | InChI=1S/C9H14N2/c1-2-4-8(3-1)9-7-10-5-6-11-9/h5,7-8,11H,1-4,6H2 |
| InChIKey | QIXLKRVKZPFFIX-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-cyclopentyl-1,2-dihydropyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-cyclopentyl-1,2-dihydropyrazine?
The IUPAC name of 6-cyclopentyl-1,2-dihydropyrazine (CID 141077395) is 6-cyclopentyl-1,2-dihydropyrazine.
What is the SMILES notation for 6-cyclopentyl-1,2-dihydropyrazine?
The canonical SMILES for 6-cyclopentyl-1,2-dihydropyrazine is C1=NC=C(C2CCCC2)NC1.
What is the InChIKey of 6-cyclopentyl-1,2-dihydropyrazine?
The InChIKey is QIXLKRVKZPFFIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2/c1-2-4-8(3-1)9-7-10-5-6-11-9/h5,7-8,11H,1-4,6H2.
What are the key properties of 6-cyclopentyl-1,2-dihydropyrazine?
6-cyclopentyl-1,2-dihydropyrazine has a molecular weight of 150.22 g/mol, XLogP of 1.69, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-cyclopentyl-1,2-dihydropyrazine is sourced from PubChem (CID 141077395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).