C16H20N2 — CID 14107777
(5aS,6aR,9S)-7,9-dimethyl-5,5a,6,6a,8,9-hexahydro-4H-indolo[4,3-fg]quinoline (PubChem CID 14107777) has the molecular formula C16H20N2 and a molecular weight of 240.35 g/mol. Its IUPAC name is (5aS,6aR,9S)-7,9-dimethyl-5,5a,6,6a,8,9-hexahydro-4H-indolo[4,3-fg]quinoline.
| Compound Name | (5aS,6aR,9S)-7,9-dimethyl-5,5a,6,6a,8,9-hexahydro-4H-indolo[4,3-fg]quinoline |
|---|---|
| PubChem CID | 14107777 |
| Molecular Formula | C16H20N2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | (5aS,6aR,9S)-7,9-dimethyl-5,5a,6,6a,8,9-hexahydro-4H-indolo[4,3-fg]quinoline |
| SMILES | C[C@H]1C=C2c3cccc4c3[C@@H](CN4)C[C@H]2N(C)C1 |
| InChI | InChI=1S/C16H20N2/c1-10-6-13-12-4-3-5-14-16(12)11(8-17-14)7-15(13)18(2)9-10/h3-6,10-11,15,17H,7-9H2,1-2H3/t10-,11+,15+/m0/s1 |
| InChIKey | OJCJIVYNZFHBOS-FIXISWKDSA-N |
| XLogP | 2.93 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |