About 2-(3-bromo-4-chlorophenyl)-1,3-dioxole
2-(3-bromo-4-chlorophenyl)-1,3-dioxole (PubChem CID 141077817) has the molecular formula C9H6BrClO2
and a molecular weight of 261.50 g/mol. Its IUPAC name is 2-(3-bromo-4-chlorophenyl)-1,3-dioxole.
Molecular Properties
| Compound Name | 2-(3-bromo-4-chlorophenyl)-1,3-dioxole |
| PubChem CID | 141077817 |
| Molecular Formula | C9H6BrClO2 |
| Molecular Weight | 261.50 g/mol |
| Exact Mass | 259.92 |
| IUPAC Name | 2-(3-bromo-4-chlorophenyl)-1,3-dioxole |
| SMILES | Clc1ccc(C2OC=CO2)cc1Br |
| InChI | InChI=1S/C9H6BrClO2/c10-7-5-6(1-2-8(7)11)9-12-3-4-13-9/h1-5,9H |
| InChIKey | GILFVPXIJAPMCU-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.50 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(3-bromo-4-chlorophenyl)-1,3-dioxole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-bromo-4-chlorophenyl)-1,3-dioxole?
The IUPAC name of 2-(3-bromo-4-chlorophenyl)-1,3-dioxole (CID 141077817) is 2-(3-bromo-4-chlorophenyl)-1,3-dioxole.
What is the SMILES notation for 2-(3-bromo-4-chlorophenyl)-1,3-dioxole?
The canonical SMILES for 2-(3-bromo-4-chlorophenyl)-1,3-dioxole is Clc1ccc(C2OC=CO2)cc1Br.
What is the InChIKey of 2-(3-bromo-4-chlorophenyl)-1,3-dioxole?
The InChIKey is GILFVPXIJAPMCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6BrClO2/c10-7-5-6(1-2-8(7)11)9-12-3-4-13-9/h1-5,9H.
What are the key properties of 2-(3-bromo-4-chlorophenyl)-1,3-dioxole?
2-(3-bromo-4-chlorophenyl)-1,3-dioxole has a molecular weight of 261.50 g/mol, XLogP of 3.62, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-bromo-4-chlorophenyl)-1,3-dioxole is sourced from PubChem (CID 141077817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).