C16H20N2O — CID 14107782
[(5aS,6aR,9R)-7-methyl-5,5a,6,6a,8,9-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]methanol (PubChem CID 14107782) has the molecular formula C16H20N2O and a molecular weight of 256.35 g/mol. Its IUPAC name is [(5aS,6aR,9R)-7-methyl-5,5a,6,6a,8,9-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]methanol.
| Compound Name | [(5aS,6aR,9R)-7-methyl-5,5a,6,6a,8,9-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]methanol |
|---|---|
| PubChem CID | 14107782 |
| Molecular Formula | C16H20N2O |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | [(5aS,6aR,9R)-7-methyl-5,5a,6,6a,8,9-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]methanol |
| SMILES | CN1C[C@H](CO)C=C2c3cccc4c3[C@@H](CN4)C[C@H]21 |
| InChI | InChI=1S/C16H20N2O/c1-18-8-10(9-19)5-13-12-3-2-4-14-16(12)11(7-17-14)6-15(13)18/h2-5,10-11,15,17,19H,6-9H2,1H3/t10-,11-,15-/m1/s1 |
| InChIKey | YEUJZVSROBECPL-UEKVPHQBSA-N |
| XLogP | 1.91 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |