C16H18N2 — CID 14107786
(5aS,6aR)-7-methyl-9-methylidene-4,5,5a,6,6a,8-hexahydroindolo[4,3-fg]quinoline (PubChem CID 14107786) has the molecular formula C16H18N2 and a molecular weight of 238.33 g/mol. Its IUPAC name is (5aS,6aR)-7-methyl-9-methylidene-4,5,5a,6,6a,8-hexahydroindolo[4,3-fg]quinoline.
| Compound Name | (5aS,6aR)-7-methyl-9-methylidene-4,5,5a,6,6a,8-hexahydroindolo[4,3-fg]quinoline |
|---|---|
| PubChem CID | 14107786 |
| Molecular Formula | C16H18N2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | (5aS,6aR)-7-methyl-9-methylidene-4,5,5a,6,6a,8-hexahydroindolo[4,3-fg]quinoline |
| SMILES | C=C1C=C2c3cccc4c3[C@@H](CN4)C[C@H]2N(C)C1 |
| InChI | InChI=1S/C16H18N2/c1-10-6-13-12-4-3-5-14-16(12)11(8-17-14)7-15(13)18(2)9-10/h3-6,11,15,17H,1,7-9H2,2H3/t11-,15-/m1/s1 |
| InChIKey | WKWHXIUYPMGHGJ-IAQYHMDHSA-N |
| XLogP | 2.85 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |