C17H22N2S — CID 14107790
(5aS,6aR,9R)-7-methyl-9-(methylsulfanylmethyl)-5,5a,6,6a,8,9-hexahydro-4H-indolo[4,3-fg]quinoline (PubChem CID 14107790) has the molecular formula C17H22N2S and a molecular weight of 286.44 g/mol. Its IUPAC name is (5aS,6aR,9R)-7-methyl-9-(methylsulfanylmethyl)-5,5a,6,6a,8,9-hexahydro-4H-indolo[4,3-fg]quinoline.
| Compound Name | (5aS,6aR,9R)-7-methyl-9-(methylsulfanylmethyl)-5,5a,6,6a,8,9-hexahydro-4H-indolo[4,3-fg]quinoline |
|---|---|
| PubChem CID | 14107790 |
| Molecular Formula | C17H22N2S |
| Molecular Weight | 286.44 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | (5aS,6aR,9R)-7-methyl-9-(methylsulfanylmethyl)-5,5a,6,6a,8,9-hexahydro-4H-indolo[4,3-fg]quinoline |
| SMILES | CSC[C@@H]1C=C2c3cccc4c3[C@@H](CN4)C[C@H]2N(C)C1 |
| InChI | InChI=1S/C17H22N2S/c1-19-9-11(10-20-2)6-14-13-4-3-5-15-17(13)12(8-18-15)7-16(14)19/h3-6,11-12,16,18H,7-10H2,1-2H3/t11-,12-,16-/m1/s1 |
| InChIKey | OZIWRHKRMMZRKP-XHBSWPGZSA-N |
| XLogP | 3.28 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.44 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |