C12H17N5O2 — CID 141078000
5-[[4-[4-(dimethylamino)but-2-ynyl]triazol-1-yl]methyl]-1,3-oxazolidin-2-one (PubChem CID 141078000) has the molecular formula C12H17N5O2 and a molecular weight of 263.30 g/mol. Its IUPAC name is 5-[[4-[4-(dimethylamino)but-2-ynyl]triazol-1-yl]methyl]-1,3-oxazolidin-2-one.
| Compound Name | 5-[[4-[4-(dimethylamino)but-2-ynyl]triazol-1-yl]methyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 141078000 |
| Molecular Formula | C12H17N5O2 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | 5-[[4-[4-(dimethylamino)but-2-ynyl]triazol-1-yl]methyl]-1,3-oxazolidin-2-one |
| SMILES | CN(C)CC#CCc1cn(CC2CNC(=O)O2)nn1 |
| InChI | InChI=1S/C12H17N5O2/c1-16(2)6-4-3-5-10-8-17(15-14-10)9-11-7-13-12(18)19-11/h8,11H,5-7,9H2,1-2H3,(H,13,18) |
| InChIKey | LWNBHUKVGAJHIS-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|