About methyl N-[[1-[(2-oxo-1,3-oxazolidin-5-yl)methyl]triazol-4-yl]methyl]carbamate
methyl N-[[1-[(2-oxo-1,3-oxazolidin-5-yl)methyl]triazol-4-yl]methyl]carbamate (PubChem CID 141078010) has the molecular formula C9H13N5O4
and a molecular weight of 255.23 g/mol. Its IUPAC name is methyl N-[[1-[(2-oxo-1,3-oxazolidin-5-yl)methyl]triazol-4-yl]methyl]carbamate.
Molecular Properties
| Compound Name | methyl N-[[1-[(2-oxo-1,3-oxazolidin-5-yl)methyl]triazol-4-yl]methyl]carbamate |
| PubChem CID | 141078010 |
| Molecular Formula | C9H13N5O4 |
| Molecular Weight | 255.23 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | methyl N-[[1-[(2-oxo-1,3-oxazolidin-5-yl)methyl]triazol-4-yl]methyl]carbamate |
| SMILES | COC(=O)NCc1cn(CC2CNC(=O)O2)nn1 |
| InChI | InChI=1S/C9H13N5O4/c1-17-8(15)10-2-6-4-14(13-12-6)5-7-3-11-9(16)18-7/h4,7H,2-3,5H2,1H3,(H,10,15)(H,11,16) |
| InChIKey | UIVPJBUDRWRVKX-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 107.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.23 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl N-[[1-[(2-oxo-1,3-oxazolidin-5-yl)methyl]triazol-4-yl]methyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-[[1-[(2-oxo-1,3-oxazolidin-5-yl)methyl]triazol-4-yl]methyl]carbamate?
The IUPAC name of methyl N-[[1-[(2-oxo-1,3-oxazolidin-5-yl)methyl]triazol-4-yl]methyl]carbamate (CID 141078010) is methyl N-[[1-[(2-oxo-1,3-oxazolidin-5-yl)methyl]triazol-4-yl]methyl]carbamate.
What is the SMILES notation for methyl N-[[1-[(2-oxo-1,3-oxazolidin-5-yl)methyl]triazol-4-yl]methyl]carbamate?
The canonical SMILES for methyl N-[[1-[(2-oxo-1,3-oxazolidin-5-yl)methyl]triazol-4-yl]methyl]carbamate is COC(=O)NCc1cn(CC2CNC(=O)O2)nn1.
What is the InChIKey of methyl N-[[1-[(2-oxo-1,3-oxazolidin-5-yl)methyl]triazol-4-yl]methyl]carbamate?
The InChIKey is UIVPJBUDRWRVKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N5O4/c1-17-8(15)10-2-6-4-14(13-12-6)5-7-3-11-9(16)18-7/h4,7H,2-3,5H2,1H3,(H,10,15)(H,11,16).
What are the key properties of methyl N-[[1-[(2-oxo-1,3-oxazolidin-5-yl)methyl]triazol-4-yl]methyl]carbamate?
methyl N-[[1-[(2-oxo-1,3-oxazolidin-5-yl)methyl]triazol-4-yl]methyl]carbamate has a molecular weight of 255.23 g/mol, XLogP of -0.76, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-[[1-[(2-oxo-1,3-oxazolidin-5-yl)methyl]triazol-4-yl]methyl]carbamate is sourced from PubChem (CID 141078010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).