About 7-amino-2-prop-2-enyl-6-oxabicyclo[3.1.1]hepta-1,3,5(7)-trien-3-ol
7-amino-2-prop-2-enyl-6-oxabicyclo[3.1.1]hepta-1,3,5(7)-trien-3-ol (PubChem CID 141078452) has the molecular formula C9H9NO2
and a molecular weight of 163.18 g/mol. Its IUPAC name is 7-amino-2-prop-2-enyl-6-oxabicyclo[3.1.1]hepta-1,3,5(7)-trien-3-ol.
Molecular Properties
| Compound Name | 7-amino-2-prop-2-enyl-6-oxabicyclo[3.1.1]hepta-1,3,5(7)-trien-3-ol |
| PubChem CID | 141078452 |
| Molecular Formula | C9H9NO2 |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.06 |
| IUPAC Name | 7-amino-2-prop-2-enyl-6-oxabicyclo[3.1.1]hepta-1,3,5(7)-trien-3-ol |
| SMILES | C=CCc1c(O)cc2c(N)c1O2 |
| InChI | InChI=1S/C9H9NO2/c1-2-3-5-6(11)4-7-8(10)9(5)12-7/h2,4,11H,1,3,10H2 |
| InChIKey | CPEGZWSIGQCJIK-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 7-amino-2-prop-2-enyl-6-oxabicyclo[3.1.1]hepta-1,3,5(7)-trien-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-amino-2-prop-2-enyl-6-oxabicyclo[3.1.1]hepta-1,3,5(7)-trien-3-ol?
The IUPAC name of 7-amino-2-prop-2-enyl-6-oxabicyclo[3.1.1]hepta-1,3,5(7)-trien-3-ol (CID 141078452) is 7-amino-2-prop-2-enyl-6-oxabicyclo[3.1.1]hepta-1,3,5(7)-trien-3-ol.
What is the SMILES notation for 7-amino-2-prop-2-enyl-6-oxabicyclo[3.1.1]hepta-1,3,5(7)-trien-3-ol?
The canonical SMILES for 7-amino-2-prop-2-enyl-6-oxabicyclo[3.1.1]hepta-1,3,5(7)-trien-3-ol is C=CCc1c(O)cc2c(N)c1O2.
What is the InChIKey of 7-amino-2-prop-2-enyl-6-oxabicyclo[3.1.1]hepta-1,3,5(7)-trien-3-ol?
The InChIKey is CPEGZWSIGQCJIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO2/c1-2-3-5-6(11)4-7-8(10)9(5)12-7/h2,4,11H,1,3,10H2.
What are the key properties of 7-amino-2-prop-2-enyl-6-oxabicyclo[3.1.1]hepta-1,3,5(7)-trien-3-ol?
7-amino-2-prop-2-enyl-6-oxabicyclo[3.1.1]hepta-1,3,5(7)-trien-3-ol has a molecular weight of 163.18 g/mol, XLogP of 1.81, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-amino-2-prop-2-enyl-6-oxabicyclo[3.1.1]hepta-1,3,5(7)-trien-3-ol is sourced from PubChem (CID 141078452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).