About 1-methyl-7-oxabicyclo[4.1.0]hepta-3,5-dien-2-ol
1-methyl-7-oxabicyclo[4.1.0]hepta-3,5-dien-2-ol (PubChem CID 141078454) has the molecular formula C7H8O2
and a molecular weight of 124.14 g/mol. Its IUPAC name is 1-methyl-7-oxabicyclo[4.1.0]hepta-3,5-dien-2-ol.
Molecular Properties
| Compound Name | 1-methyl-7-oxabicyclo[4.1.0]hepta-3,5-dien-2-ol |
| PubChem CID | 141078454 |
| Molecular Formula | C7H8O2 |
| Molecular Weight | 124.14 g/mol |
| Exact Mass | 124.05 |
| IUPAC Name | 1-methyl-7-oxabicyclo[4.1.0]hepta-3,5-dien-2-ol |
| SMILES | CC12OC1=CC=CC2O |
| InChI | InChI=1S/C7H8O2/c1-7-5(8)3-2-4-6(7)9-7/h2-5,8H,1H3 |
| InChIKey | NIKAZYPLINBPFF-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.14 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-7-oxabicyclo[4.1.0]hepta-3,5-dien-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-7-oxabicyclo[4.1.0]hepta-3,5-dien-2-ol?
The IUPAC name of 1-methyl-7-oxabicyclo[4.1.0]hepta-3,5-dien-2-ol (CID 141078454) is 1-methyl-7-oxabicyclo[4.1.0]hepta-3,5-dien-2-ol.
What is the SMILES notation for 1-methyl-7-oxabicyclo[4.1.0]hepta-3,5-dien-2-ol?
The canonical SMILES for 1-methyl-7-oxabicyclo[4.1.0]hepta-3,5-dien-2-ol is CC12OC1=CC=CC2O.
What is the InChIKey of 1-methyl-7-oxabicyclo[4.1.0]hepta-3,5-dien-2-ol?
The InChIKey is NIKAZYPLINBPFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O2/c1-7-5(8)3-2-4-6(7)9-7/h2-5,8H,1H3.
What are the key properties of 1-methyl-7-oxabicyclo[4.1.0]hepta-3,5-dien-2-ol?
1-methyl-7-oxabicyclo[4.1.0]hepta-3,5-dien-2-ol has a molecular weight of 124.14 g/mol, XLogP of 0.59, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-7-oxabicyclo[4.1.0]hepta-3,5-dien-2-ol is sourced from PubChem (CID 141078454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).