C9H6Cl2F5NO — CID 141078575
3,5-dichloro-4-(1,2,3,3,3-pentafluoropropoxy)aniline (PubChem CID 141078575) has the molecular formula C9H6Cl2F5NO and a molecular weight of 310.05 g/mol. Its IUPAC name is 3,5-dichloro-4-(1,2,3,3,3-pentafluoropropoxy)aniline.
| Compound Name | 3,5-dichloro-4-(1,2,3,3,3-pentafluoropropoxy)aniline |
|---|---|
| PubChem CID | 141078575 |
| Molecular Formula | C9H6Cl2F5NO |
| Molecular Weight | 310.05 g/mol |
| Exact Mass | 308.97 |
| IUPAC Name | 3,5-dichloro-4-(1,2,3,3,3-pentafluoropropoxy)aniline |
| SMILES | Nc1cc(Cl)c(OC(F)C(F)C(F)(F)F)c(Cl)c1 |
| InChI | InChI=1S/C9H6Cl2F5NO/c10-4-1-3(17)2-5(11)6(4)18-8(13)7(12)9(14,15)16/h1-2,7-8H,17H2 |
| InChIKey | YXHMKUOQEOPILD-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.05 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|