C24H28OSe — CID 141078996
7-ethynylselanyl-1,1,4,4-tetramethyl-5-[(4-methylphenyl)methoxy]-2,3-dihydronaphthalene (PubChem CID 141078996) has the molecular formula C24H28OSe and a molecular weight of 411.45 g/mol. Its IUPAC name is 7-ethynylselanyl-1,1,4,4-tetramethyl-5-[(4-methylphenyl)methoxy]-2,3-dihydronaphthalene.
| Compound Name | 7-ethynylselanyl-1,1,4,4-tetramethyl-5-[(4-methylphenyl)methoxy]-2,3-dihydronaphthalene |
|---|---|
| PubChem CID | 141078996 |
| Molecular Formula | C24H28OSe |
| Molecular Weight | 411.45 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | 7-ethynylselanyl-1,1,4,4-tetramethyl-5-[(4-methylphenyl)methoxy]-2,3-dihydronaphthalene |
| SMILES | C#C[Se]c1cc(OCc2ccc(C)cc2)c2c(c1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C24H28OSe/c1-7-26-19-14-20-22(24(5,6)13-12-23(20,3)4)21(15-19)25-16-18-10-8-17(2)9-11-18/h1,8-11,14-15H,12-13,16H2,2-6H3 |
| InChIKey | WDPGLWHXOBFOFI-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.45 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|