About (pyrazol-1-ylamino)urea
(pyrazol-1-ylamino)urea (PubChem CID 141079323) has the molecular formula C4H7N5O
and a molecular weight of 141.13 g/mol. Its IUPAC name is (pyrazol-1-ylamino)urea.
Molecular Properties
| Compound Name | (pyrazol-1-ylamino)urea |
| PubChem CID | 141079323 |
| Molecular Formula | C4H7N5O |
| Molecular Weight | 141.13 g/mol |
| Exact Mass | 141.07 |
| IUPAC Name | (pyrazol-1-ylamino)urea |
| SMILES | NC(=O)NNn1cccn1 |
| InChI | InChI=1S/C4H7N5O/c5-4(10)7-8-9-3-1-2-6-9/h1-3,8H,(H3,5,7,10) |
| InChIKey | GEXKVARXHLGARJ-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 84.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.13 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (pyrazol-1-ylamino)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (pyrazol-1-ylamino)urea?
The IUPAC name of (pyrazol-1-ylamino)urea (CID 141079323) is (pyrazol-1-ylamino)urea.
What is the SMILES notation for (pyrazol-1-ylamino)urea?
The canonical SMILES for (pyrazol-1-ylamino)urea is NC(=O)NNn1cccn1.
What is the InChIKey of (pyrazol-1-ylamino)urea?
The InChIKey is GEXKVARXHLGARJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7N5O/c5-4(10)7-8-9-3-1-2-6-9/h1-3,8H,(H3,5,7,10).
What are the key properties of (pyrazol-1-ylamino)urea?
(pyrazol-1-ylamino)urea has a molecular weight of 141.13 g/mol, XLogP of -0.99, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (pyrazol-1-ylamino)urea is sourced from PubChem (CID 141079323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).