C6H6FN3 — CID 141079333
(1R,4S,5R,6R)-4-azido-6-fluorobicyclo[3.1.0]hex-2-ene (PubChem CID 141079333) has the molecular formula C6H6FN3 and a molecular weight of 139.13 g/mol. Its IUPAC name is (1R,4S,5R,6R)-4-azido-6-fluorobicyclo[3.1.0]hex-2-ene.
| Compound Name | (1R,4S,5R,6R)-4-azido-6-fluorobicyclo[3.1.0]hex-2-ene |
|---|---|
| PubChem CID | 141079333 |
| Molecular Formula | C6H6FN3 |
| Molecular Weight | 139.13 g/mol |
| Exact Mass | 139.05 |
| IUPAC Name | (1R,4S,5R,6R)-4-azido-6-fluorobicyclo[3.1.0]hex-2-ene |
| SMILES | [N-]=[N+]=N[C@H]1C=C[C@H]2[C@@H](F)[C@H]21 |
| InChI | InChI=1S/C6H6FN3/c7-6-3-1-2-4(5(3)6)9-10-8/h1-6H/t3-,4+,5-,6-/m1/s1 |
| InChIKey | CFCCYBLBOWYCBK-JGWLITMVSA-N |
| XLogP | 1.82 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.13 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|