C15H29N3 — CID 141079354
(3S)-3-(2-methylpropyl)-1-[(Z)-2-piperidin-2-ylethenyl]piperazine (PubChem CID 141079354) has the molecular formula C15H29N3 and a molecular weight of 251.42 g/mol. Its IUPAC name is (3S)-3-(2-methylpropyl)-1-[(Z)-2-piperidin-2-ylethenyl]piperazine.
| Compound Name | (3S)-3-(2-methylpropyl)-1-[(Z)-2-piperidin-2-ylethenyl]piperazine |
|---|---|
| PubChem CID | 141079354 |
| Molecular Formula | C15H29N3 |
| Molecular Weight | 251.42 g/mol |
| Exact Mass | 251.24 |
| IUPAC Name | (3S)-3-(2-methylpropyl)-1-[(Z)-2-piperidin-2-ylethenyl]piperazine |
| SMILES | CC(C)C[C@H]1CN(/C=C\C2CCCCN2)CCN1 |
| InChI | InChI=1S/C15H29N3/c1-13(2)11-15-12-18(10-8-17-15)9-6-14-5-3-4-7-16-14/h6,9,13-17H,3-5,7-8,10-12H2,1-2H3/b9-6-/t14?,15-/m0/s1 |
| InChIKey | QXVNERLDJWSHDU-WWHUVMKASA-N |
| XLogP | 1.96 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.42 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |