C23H28N6 — CID 141079623
3-[6-(4-ethylpiperazin-1-yl)-1H-benzimidazol-2-yl]-1-methyl-2H-quinolin-4-amine (PubChem CID 141079623) has the molecular formula C23H28N6 and a molecular weight of 388.52 g/mol. Its IUPAC name is 3-[6-(4-ethylpiperazin-1-yl)-1H-benzimidazol-2-yl]-1-methyl-2H-quinolin-4-amine.
| Compound Name | 3-[6-(4-ethylpiperazin-1-yl)-1H-benzimidazol-2-yl]-1-methyl-2H-quinolin-4-amine |
|---|---|
| PubChem CID | 141079623 |
| Molecular Formula | C23H28N6 |
| Molecular Weight | 388.52 g/mol |
| Exact Mass | 388.24 |
| IUPAC Name | 3-[6-(4-ethylpiperazin-1-yl)-1H-benzimidazol-2-yl]-1-methyl-2H-quinolin-4-amine |
| SMILES | CCN1CCN(c2ccc3nc(C4=C(N)c5ccccc5N(C)C4)[nH]c3c2)CC1 |
| InChI | InChI=1S/C23H28N6/c1-3-28-10-12-29(13-11-28)16-8-9-19-20(14-16)26-23(25-19)18-15-27(2)21-7-5-4-6-17(21)22(18)24/h4-9,14H,3,10-13,15,24H2,1-2H3,(H,25,26) |
| InChIKey | PMIWNIUGVQDVKV-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 64.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.52 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |