About (5R)-N-cyclohexa-1,5-dien-1-yl-5-(methoxymethyl)pyrrolidin-3-amine
(5R)-N-cyclohexa-1,5-dien-1-yl-5-(methoxymethyl)pyrrolidin-3-amine (PubChem CID 141079639) has the molecular formula C12H20N2O
and a molecular weight of 208.31 g/mol. Its IUPAC name is (5R)-N-cyclohexa-1,5-dien-1-yl-5-(methoxymethyl)pyrrolidin-3-amine.
Molecular Properties
| Compound Name | (5R)-N-cyclohexa-1,5-dien-1-yl-5-(methoxymethyl)pyrrolidin-3-amine |
| PubChem CID | 141079639 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | (5R)-N-cyclohexa-1,5-dien-1-yl-5-(methoxymethyl)pyrrolidin-3-amine |
| SMILES | COC[C@H]1CC(NC2=CCCC=C2)CN1 |
| InChI | InChI=1S/C12H20N2O/c1-15-9-12-7-11(8-13-12)14-10-5-3-2-4-6-10/h3,5-6,11-14H,2,4,7-9H2,1H3/t11?,12-/m1/s1 |
| InChIKey | WTGMAVJILRAKMP-PIJUOVFKSA-N |
| XLogP | 1.19 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (5R)-N-cyclohexa-1,5-dien-1-yl-5-(methoxymethyl)pyrrolidin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-N-cyclohexa-1,5-dien-1-yl-5-(methoxymethyl)pyrrolidin-3-amine?
The IUPAC name of (5R)-N-cyclohexa-1,5-dien-1-yl-5-(methoxymethyl)pyrrolidin-3-amine (CID 141079639) is (5R)-N-cyclohexa-1,5-dien-1-yl-5-(methoxymethyl)pyrrolidin-3-amine.
What is the SMILES notation for (5R)-N-cyclohexa-1,5-dien-1-yl-5-(methoxymethyl)pyrrolidin-3-amine?
The canonical SMILES for (5R)-N-cyclohexa-1,5-dien-1-yl-5-(methoxymethyl)pyrrolidin-3-amine is COC[C@H]1CC(NC2=CCCC=C2)CN1.
What is the InChIKey of (5R)-N-cyclohexa-1,5-dien-1-yl-5-(methoxymethyl)pyrrolidin-3-amine?
The InChIKey is WTGMAVJILRAKMP-PIJUOVFKSA-N. The full InChI is InChI=1S/C12H20N2O/c1-15-9-12-7-11(8-13-12)14-10-5-3-2-4-6-10/h3,5-6,11-14H,2,4,7-9H2,1H3/t11?,12-/m1/s1.
What are the key properties of (5R)-N-cyclohexa-1,5-dien-1-yl-5-(methoxymethyl)pyrrolidin-3-amine?
(5R)-N-cyclohexa-1,5-dien-1-yl-5-(methoxymethyl)pyrrolidin-3-amine has a molecular weight of 208.31 g/mol, XLogP of 1.19, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-N-cyclohexa-1,5-dien-1-yl-5-(methoxymethyl)pyrrolidin-3-amine is sourced from PubChem (CID 141079639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).