C10H15NO4S2 — CID 141079765
hydroxy-oxo-sulfanylidene-(1,2,4,5-tetramethyl-4-nitrocyclohexa-2,5-dien-1-yl)-λ6-sulfane (PubChem CID 141079765) has the molecular formula C10H15NO4S2 and a molecular weight of 277.37 g/mol. Its IUPAC name is hydroxy-oxo-sulfanylidene-(1,2,4,5-tetramethyl-4-nitrocyclohexa-2,5-dien-1-yl)-λ6-sulfane.
| Compound Name | hydroxy-oxo-sulfanylidene-(1,2,4,5-tetramethyl-4-nitrocyclohexa-2,5-dien-1-yl)-λ6-sulfane |
|---|---|
| PubChem CID | 141079765 |
| Molecular Formula | C10H15NO4S2 |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.04 |
| IUPAC Name | hydroxy-oxo-sulfanylidene-(1,2,4,5-tetramethyl-4-nitrocyclohexa-2,5-dien-1-yl)-λ6-sulfane |
| SMILES | CC1=CC(C)(S(=O)(O)=S)C(C)=CC1(C)[N+](=O)[O-] |
| InChI | InChI=1S/C10H15NO4S2/c1-7-6-10(4,17(14,15)16)8(2)5-9(7,3)11(12)13/h5-6H,1-4H3,(H,14,15,16) |
| InChIKey | UFNUWOPJYFKVRV-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|