C13H24O4 — CID 141080519
1,1-di(propan-2-yloxy)heptane-2,3-dione (PubChem CID 141080519) has the molecular formula C13H24O4 and a molecular weight of 244.33 g/mol. Its IUPAC name is 1,1-di(propan-2-yloxy)heptane-2,3-dione.
| Compound Name | 1,1-di(propan-2-yloxy)heptane-2,3-dione |
|---|---|
| PubChem CID | 141080519 |
| Molecular Formula | C13H24O4 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.17 |
| IUPAC Name | 1,1-di(propan-2-yloxy)heptane-2,3-dione |
| SMILES | CCCCC(=O)C(=O)C(OC(C)C)OC(C)C |
| InChI | InChI=1S/C13H24O4/c1-6-7-8-11(14)12(15)13(16-9(2)3)17-10(4)5/h9-10,13H,6-8H2,1-5H3 |
| InChIKey | STPIJEJNDOXZAE-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|