C15H10Cl2 — CID 141080576
6,13-dichlorotricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaene (PubChem CID 141080576) has the molecular formula C15H10Cl2 and a molecular weight of 261.15 g/mol. Its IUPAC name is 6,13-dichlorotricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaene.
| Compound Name | 6,13-dichlorotricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaene |
|---|---|
| PubChem CID | 141080576 |
| Molecular Formula | C15H10Cl2 |
| Molecular Weight | 261.15 g/mol |
| Exact Mass | 260.02 |
| IUPAC Name | 6,13-dichlorotricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaene |
| SMILES | Clc1ccc2c(c1)C=Cc1cc(Cl)ccc1C2 |
| InChI | InChI=1S/C15H10Cl2/c16-14-5-3-10-7-11-4-6-15(17)9-13(11)2-1-12(10)8-14/h1-6,8-9H,7H2 |
| InChIKey | AORUJITVHRMBKP-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.15 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|