About [8-fluoro-2,3-dimethyl-6-(2-methylbutan-2-yl)quinolin-4-yl] acetate
[8-fluoro-2,3-dimethyl-6-(2-methylbutan-2-yl)quinolin-4-yl] acetate (PubChem CID 141081221) has the molecular formula C18H22FNO2
and a molecular weight of 303.38 g/mol. Its IUPAC name is [8-fluoro-2,3-dimethyl-6-(2-methylbutan-2-yl)quinolin-4-yl] acetate.
Molecular Properties
| Compound Name | [8-fluoro-2,3-dimethyl-6-(2-methylbutan-2-yl)quinolin-4-yl] acetate |
| PubChem CID | 141081221 |
| Molecular Formula | C18H22FNO2 |
| Molecular Weight | 303.38 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | [8-fluoro-2,3-dimethyl-6-(2-methylbutan-2-yl)quinolin-4-yl] acetate |
| SMILES | CCC(C)(C)c1cc(F)c2nc(C)c(C)c(OC(C)=O)c2c1 |
| InChI | InChI=1S/C18H22FNO2/c1-7-18(5,6)13-8-14-16(15(19)9-13)20-11(3)10(2)17(14)22-12(4)21/h8-9H,7H2,1-6H3 |
| InChIKey | IGYRYOOEZOEIRP-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.38 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [8-fluoro-2,3-dimethyl-6-(2-methylbutan-2-yl)quinolin-4-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [8-fluoro-2,3-dimethyl-6-(2-methylbutan-2-yl)quinolin-4-yl] acetate?
The IUPAC name of [8-fluoro-2,3-dimethyl-6-(2-methylbutan-2-yl)quinolin-4-yl] acetate (CID 141081221) is [8-fluoro-2,3-dimethyl-6-(2-methylbutan-2-yl)quinolin-4-yl] acetate.
What is the SMILES notation for [8-fluoro-2,3-dimethyl-6-(2-methylbutan-2-yl)quinolin-4-yl] acetate?
The canonical SMILES for [8-fluoro-2,3-dimethyl-6-(2-methylbutan-2-yl)quinolin-4-yl] acetate is CCC(C)(C)c1cc(F)c2nc(C)c(C)c(OC(C)=O)c2c1.
What is the InChIKey of [8-fluoro-2,3-dimethyl-6-(2-methylbutan-2-yl)quinolin-4-yl] acetate?
The InChIKey is IGYRYOOEZOEIRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22FNO2/c1-7-18(5,6)13-8-14-16(15(19)9-13)20-11(3)10(2)17(14)22-12(4)21/h8-9H,7H2,1-6H3.
What are the key properties of [8-fluoro-2,3-dimethyl-6-(2-methylbutan-2-yl)quinolin-4-yl] acetate?
[8-fluoro-2,3-dimethyl-6-(2-methylbutan-2-yl)quinolin-4-yl] acetate has a molecular weight of 303.38 g/mol, XLogP of 4.60, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [8-fluoro-2,3-dimethyl-6-(2-methylbutan-2-yl)quinolin-4-yl] acetate is sourced from PubChem (CID 141081221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).