C9H16N2 — CID 141081524
2-methyl-1,2,3,4,4a,5,6,7-octahydro-1,8-naphthyridine (PubChem CID 141081524) has the molecular formula C9H16N2 and a molecular weight of 152.24 g/mol. Its IUPAC name is 2-methyl-1,2,3,4,4a,5,6,7-octahydro-1,8-naphthyridine.
| Compound Name | 2-methyl-1,2,3,4,4a,5,6,7-octahydro-1,8-naphthyridine |
|---|---|
| PubChem CID | 141081524 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | 2-methyl-1,2,3,4,4a,5,6,7-octahydro-1,8-naphthyridine |
| SMILES | CC1CCC2CCCN=C2N1 |
| InChI | InChI=1S/C9H16N2/c1-7-4-5-8-3-2-6-10-9(8)11-7/h7-8H,2-6H2,1H3,(H,10,11) |
| InChIKey | IPKOGXOWLLMQLC-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |