About 5-amino-7-chloro-1-cyclopropyl-6,8-difluoroquinolin-4-one
5-amino-7-chloro-1-cyclopropyl-6,8-difluoroquinolin-4-one (PubChem CID 141081551) has the molecular formula C12H9ClF2N2O
and a molecular weight of 270.67 g/mol. Its IUPAC name is 5-amino-7-chloro-1-cyclopropyl-6,8-difluoroquinolin-4-one.
Molecular Properties
| Compound Name | 5-amino-7-chloro-1-cyclopropyl-6,8-difluoroquinolin-4-one |
| PubChem CID | 141081551 |
| Molecular Formula | C12H9ClF2N2O |
| Molecular Weight | 270.67 g/mol |
| Exact Mass | 270.04 |
| IUPAC Name | 5-amino-7-chloro-1-cyclopropyl-6,8-difluoroquinolin-4-one |
| SMILES | Nc1c(F)c(Cl)c(F)c2c1c(=O)ccn2C1CC1 |
| InChI | InChI=1S/C12H9ClF2N2O/c13-8-9(14)11(16)7-6(18)3-4-17(5-1-2-5)12(7)10(8)15/h3-5H,1-2,16H2 |
| InChIKey | ZQLIORGRCHPWIB-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.67 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-7-chloro-1-cyclopropyl-6,8-difluoroquinolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-7-chloro-1-cyclopropyl-6,8-difluoroquinolin-4-one?
The IUPAC name of 5-amino-7-chloro-1-cyclopropyl-6,8-difluoroquinolin-4-one (CID 141081551) is 5-amino-7-chloro-1-cyclopropyl-6,8-difluoroquinolin-4-one.
What is the SMILES notation for 5-amino-7-chloro-1-cyclopropyl-6,8-difluoroquinolin-4-one?
The canonical SMILES for 5-amino-7-chloro-1-cyclopropyl-6,8-difluoroquinolin-4-one is Nc1c(F)c(Cl)c(F)c2c1c(=O)ccn2C1CC1.
What is the InChIKey of 5-amino-7-chloro-1-cyclopropyl-6,8-difluoroquinolin-4-one?
The InChIKey is ZQLIORGRCHPWIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9ClF2N2O/c13-8-9(14)11(16)7-6(18)3-4-17(5-1-2-5)12(7)10(8)15/h3-5H,1-2,16H2.
What are the key properties of 5-amino-7-chloro-1-cyclopropyl-6,8-difluoroquinolin-4-one?
5-amino-7-chloro-1-cyclopropyl-6,8-difluoroquinolin-4-one has a molecular weight of 270.67 g/mol, XLogP of 2.85, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-7-chloro-1-cyclopropyl-6,8-difluoroquinolin-4-one is sourced from PubChem (CID 141081551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).