About 2-(6,6-diethoxycyclohexa-2,4-dien-1-yl)acetaldehyde
2-(6,6-diethoxycyclohexa-2,4-dien-1-yl)acetaldehyde (PubChem CID 141081937) has the molecular formula C12H18O3
and a molecular weight of 210.27 g/mol. Its IUPAC name is 2-(6,6-diethoxycyclohexa-2,4-dien-1-yl)acetaldehyde.
Molecular Properties
| Compound Name | 2-(6,6-diethoxycyclohexa-2,4-dien-1-yl)acetaldehyde |
| PubChem CID | 141081937 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | 2-(6,6-diethoxycyclohexa-2,4-dien-1-yl)acetaldehyde |
| SMILES | CCOC1(OCC)C=CC=CC1CC=O |
| InChI | InChI=1S/C12H18O3/c1-3-14-12(15-4-2)9-6-5-7-11(12)8-10-13/h5-7,9-11H,3-4,8H2,1-2H3 |
| InChIKey | VWTZVTZTZPLZFA-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-(6,6-diethoxycyclohexa-2,4-dien-1-yl)acetaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6,6-diethoxycyclohexa-2,4-dien-1-yl)acetaldehyde?
The IUPAC name of 2-(6,6-diethoxycyclohexa-2,4-dien-1-yl)acetaldehyde (CID 141081937) is 2-(6,6-diethoxycyclohexa-2,4-dien-1-yl)acetaldehyde.
What is the SMILES notation for 2-(6,6-diethoxycyclohexa-2,4-dien-1-yl)acetaldehyde?
The canonical SMILES for 2-(6,6-diethoxycyclohexa-2,4-dien-1-yl)acetaldehyde is CCOC1(OCC)C=CC=CC1CC=O.
What is the InChIKey of 2-(6,6-diethoxycyclohexa-2,4-dien-1-yl)acetaldehyde?
The InChIKey is VWTZVTZTZPLZFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O3/c1-3-14-12(15-4-2)9-6-5-7-11(12)8-10-13/h5-7,9-11H,3-4,8H2,1-2H3.
What are the key properties of 2-(6,6-diethoxycyclohexa-2,4-dien-1-yl)acetaldehyde?
2-(6,6-diethoxycyclohexa-2,4-dien-1-yl)acetaldehyde has a molecular weight of 210.27 g/mol, XLogP of 2.09, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6,6-diethoxycyclohexa-2,4-dien-1-yl)acetaldehyde is sourced from PubChem (CID 141081937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).