C46H92O4Si3 — CID 141081970
triethyl-[1-[3-[16,16,17,17-tetramethyl-2,15-bis(triethylsilyloxy)octadeca-3,5,9-trienyl]oxiran-2-yl]butan-2-yloxy]silane (PubChem CID 141081970) has the molecular formula C46H92O4Si3 and a molecular weight of 793.50 g/mol. Its IUPAC name is triethyl-[1-[3-[16,16,17,17-tetramethyl-2,15-bis(triethylsilyloxy)octadeca-3,5,9-trienyl]oxiran-2-yl]butan-2-yloxy]silane.
| Compound Name | triethyl-[1-[3-[16,16,17,17-tetramethyl-2,15-bis(triethylsilyloxy)octadeca-3,5,9-trienyl]oxiran-2-yl]butan-2-yloxy]silane |
|---|---|
| PubChem CID | 141081970 |
| Molecular Formula | C46H92O4Si3 |
| Molecular Weight | 793.50 g/mol |
| Exact Mass | 792.63 |
| IUPAC Name | triethyl-[1-[3-[16,16,17,17-tetramethyl-2,15-bis(triethylsilyloxy)octadeca-3,5,9-trienyl]oxiran-2-yl]butan-2-yloxy]silane |
| SMILES | CCC(CC1OC1CC(C=CC=CCCC=CCCCCC(O[Si](CC)(CC)CC)C(C)(C)C(C)(C)C)O[Si](CC)(CC)CC)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C46H92O4Si3/c1-16-40(48-51(17-2,18-3)19-4)38-42-43(47-42)39-41(49-52(20-5,21-6)22-7)36-34-32-30-28-26-27-29-31-33-35-37-44(46(14,15)45(11,12)13)50-53(23-8,24-9)25-10/h27,29-30,32,34,36,40-44H,16-26,28,31,33,35,37-39H2,1-15H3 |
| InChIKey | JZPIYKRKKZQHHG-UHFFFAOYSA-N |
| XLogP | 15.20 |
| TPSA | 40.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 793.50 |
| LogP ≤ 5 | 15.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|