About N'-[(E,6S)-6-amino-2-fluorohept-2-enyl]ethanimidamide
N'-[(E,6S)-6-amino-2-fluorohept-2-enyl]ethanimidamide (PubChem CID 141082217) has the molecular formula C9H18FN3
and a molecular weight of 187.26 g/mol. Its IUPAC name is N'-[(E,6S)-6-amino-2-fluorohept-2-enyl]ethanimidamide.
Molecular Properties
| Compound Name | N'-[(E,6S)-6-amino-2-fluorohept-2-enyl]ethanimidamide |
| PubChem CID | 141082217 |
| Molecular Formula | C9H18FN3 |
| Molecular Weight | 187.26 g/mol |
| Exact Mass | 187.15 |
| IUPAC Name | N'-[(E,6S)-6-amino-2-fluorohept-2-enyl]ethanimidamide |
| SMILES | C/C(N)=N\C/C(F)=C\CC[C@H](C)N |
| InChI | InChI=1S/C9H18FN3/c1-7(11)4-3-5-9(10)6-13-8(2)12/h5,7H,3-4,6,11H2,1-2H3,(H2,12,13)/b9-5+/t7-/m0/s1 |
| InChIKey | LKXRKEXXUBOXSF-JGESFRBXSA-N |
| XLogP | 1.34 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.26 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-[(E,6S)-6-amino-2-fluorohept-2-enyl]ethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[(E,6S)-6-amino-2-fluorohept-2-enyl]ethanimidamide?
The IUPAC name of N'-[(E,6S)-6-amino-2-fluorohept-2-enyl]ethanimidamide (CID 141082217) is N'-[(E,6S)-6-amino-2-fluorohept-2-enyl]ethanimidamide.
What is the SMILES notation for N'-[(E,6S)-6-amino-2-fluorohept-2-enyl]ethanimidamide?
The canonical SMILES for N'-[(E,6S)-6-amino-2-fluorohept-2-enyl]ethanimidamide is C/C(N)=N\C/C(F)=C\CC[C@H](C)N.
What is the InChIKey of N'-[(E,6S)-6-amino-2-fluorohept-2-enyl]ethanimidamide?
The InChIKey is LKXRKEXXUBOXSF-JGESFRBXSA-N. The full InChI is InChI=1S/C9H18FN3/c1-7(11)4-3-5-9(10)6-13-8(2)12/h5,7H,3-4,6,11H2,1-2H3,(H2,12,13)/b9-5+/t7-/m0/s1.
What are the key properties of N'-[(E,6S)-6-amino-2-fluorohept-2-enyl]ethanimidamide?
N'-[(E,6S)-6-amino-2-fluorohept-2-enyl]ethanimidamide has a molecular weight of 187.26 g/mol, XLogP of 1.34, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[(E,6S)-6-amino-2-fluorohept-2-enyl]ethanimidamide is sourced from PubChem (CID 141082217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).