C11H16N4 — CID 141082770
6-piperidin-4-yl-4,7-dihydro-1H-pyrazolo[5,4-b]pyridine (PubChem CID 141082770) has the molecular formula C11H16N4 and a molecular weight of 204.28 g/mol. Its IUPAC name is 6-piperidin-4-yl-4,7-dihydro-1H-pyrazolo[5,4-b]pyridine.
| Compound Name | 6-piperidin-4-yl-4,7-dihydro-1H-pyrazolo[5,4-b]pyridine |
|---|---|
| PubChem CID | 141082770 |
| Molecular Formula | C11H16N4 |
| Molecular Weight | 204.28 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | 6-piperidin-4-yl-4,7-dihydro-1H-pyrazolo[5,4-b]pyridine |
| SMILES | C1=C(C2CCNCC2)Nc2[nH]ncc2C1 |
| InChI | InChI=1S/C11H16N4/c1-2-10(8-3-5-12-6-4-8)14-11-9(1)7-13-15-11/h2,7-8,12H,1,3-6H2,(H2,13,14,15) |
| InChIKey | UQFWPGWUDPDQSQ-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 52.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.28 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |