C12H20O — CID 141082850
4-ethenyl-2,2,3,3-tetramethylcyclohexan-1-one (PubChem CID 141082850) has the molecular formula C12H20O and a molecular weight of 180.29 g/mol. Its IUPAC name is 4-ethenyl-2,2,3,3-tetramethylcyclohexan-1-one.
| Compound Name | 4-ethenyl-2,2,3,3-tetramethylcyclohexan-1-one |
|---|---|
| PubChem CID | 141082850 |
| Molecular Formula | C12H20O |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.15 |
| IUPAC Name | 4-ethenyl-2,2,3,3-tetramethylcyclohexan-1-one |
| SMILES | C=CC1CCC(=O)C(C)(C)C1(C)C |
| InChI | InChI=1S/C12H20O/c1-6-9-7-8-10(13)12(4,5)11(9,2)3/h6,9H,1,7-8H2,2-5H3 |
| InChIKey | ALFPLGKOLHSKMS-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|