C15H16N2O — CID 141082946
3-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-3a,4-dihydro-1H-indol-2-one (PubChem CID 141082946) has the molecular formula C15H16N2O and a molecular weight of 240.31 g/mol. Its IUPAC name is 3-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-3a,4-dihydro-1H-indol-2-one.
| Compound Name | 3-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-3a,4-dihydro-1H-indol-2-one |
|---|---|
| PubChem CID | 141082946 |
| Molecular Formula | C15H16N2O |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | 3-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-3a,4-dihydro-1H-indol-2-one |
| SMILES | Cc1cc(C)c(C=C2C(=O)NC3=CC=CCC32)[nH]1 |
| InChI | InChI=1S/C15H16N2O/c1-9-7-10(2)16-14(9)8-12-11-5-3-4-6-13(11)17-15(12)18/h3-4,6-8,11,16H,5H2,1-2H3,(H,17,18) |
| InChIKey | ULMHSSZAVKUVBP-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|