About thiophen-3-ylmethyl N-[(2,4,5-trifluorophenyl)methyl]carbamate
thiophen-3-ylmethyl N-[(2,4,5-trifluorophenyl)methyl]carbamate (PubChem CID 141082992) has the molecular formula C13H10F3NO2S
and a molecular weight of 301.29 g/mol. Its IUPAC name is thiophen-3-ylmethyl N-[(2,4,5-trifluorophenyl)methyl]carbamate.
Molecular Properties
| Compound Name | thiophen-3-ylmethyl N-[(2,4,5-trifluorophenyl)methyl]carbamate |
| PubChem CID | 141082992 |
| Molecular Formula | C13H10F3NO2S |
| Molecular Weight | 301.29 g/mol |
| Exact Mass | 301.04 |
| IUPAC Name | thiophen-3-ylmethyl N-[(2,4,5-trifluorophenyl)methyl]carbamate |
| SMILES | O=C(NCc1cc(F)c(F)cc1F)OCc1ccsc1 |
| InChI | InChI=1S/C13H10F3NO2S/c14-10-4-12(16)11(15)3-9(10)5-17-13(18)19-6-8-1-2-20-7-8/h1-4,7H,5-6H2,(H,17,18) |
| InChIKey | DSCRMSKHOXBSCI-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.29 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze thiophen-3-ylmethyl N-[(2,4,5-trifluorophenyl)methyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thiophen-3-ylmethyl N-[(2,4,5-trifluorophenyl)methyl]carbamate?
The IUPAC name of thiophen-3-ylmethyl N-[(2,4,5-trifluorophenyl)methyl]carbamate (CID 141082992) is thiophen-3-ylmethyl N-[(2,4,5-trifluorophenyl)methyl]carbamate.
What is the SMILES notation for thiophen-3-ylmethyl N-[(2,4,5-trifluorophenyl)methyl]carbamate?
The canonical SMILES for thiophen-3-ylmethyl N-[(2,4,5-trifluorophenyl)methyl]carbamate is O=C(NCc1cc(F)c(F)cc1F)OCc1ccsc1.
What is the InChIKey of thiophen-3-ylmethyl N-[(2,4,5-trifluorophenyl)methyl]carbamate?
The InChIKey is DSCRMSKHOXBSCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10F3NO2S/c14-10-4-12(16)11(15)3-9(10)5-17-13(18)19-6-8-1-2-20-7-8/h1-4,7H,5-6H2,(H,17,18).
What are the key properties of thiophen-3-ylmethyl N-[(2,4,5-trifluorophenyl)methyl]carbamate?
thiophen-3-ylmethyl N-[(2,4,5-trifluorophenyl)methyl]carbamate has a molecular weight of 301.29 g/mol, XLogP of 3.59, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for thiophen-3-ylmethyl N-[(2,4,5-trifluorophenyl)methyl]carbamate is sourced from PubChem (CID 141082992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).